C22H18N2O6 — CID 19057350
3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 19057350) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 19057350 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)/C(=C/c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O6/c1-29-19-10-9-15(22(27)28)12-17(19)23-21(26)18(13-16-8-5-11-30-16)24-20(25)14-6-3-2-4-7-14/h2-13H,1H3,(H,23,26)(H,24,25)(H,27,28)/b18-13- |
| InChIKey | COUDXHGOZNEYRP-AQTBWJFISA-N |
| XLogP | 3.40 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|