C26H21N3O5 — CID 19057441
3-[[(Z)-2-benzamido-3-(1H-indol-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 19057441) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-(1H-indol-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(Z)-2-benzamido-3-(1H-indol-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 19057441 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-(1H-indol-2-yl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)/C(=C/c1cc2ccccc2[nH]1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O5/c1-34-23-12-11-18(26(32)33)14-21(23)28-25(31)22(29-24(30)16-7-3-2-4-8-16)15-19-13-17-9-5-6-10-20(17)27-19/h2-15,27H,1H3,(H,28,31)(H,29,30)(H,32,33)/b22-15- |
| InChIKey | QXFQRCITAJBVEL-JCMHNJIXSA-N |
| XLogP | 4.28 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|