C37H36N4O6 — CID 139228873
N-[(E)-3-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]propylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 139228873) has the molecular formula C37H36N4O6 and a molecular weight of 632.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]propylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]propylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 139228873 |
| Molecular Formula | C37H36N4O6 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | N-[(E)-3-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]propylamino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)NCCCNC(=O)/C(=C\c1ccccc1OC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H36N4O6/c1-46-32-20-11-9-18-28(32)24-30(40-34(42)26-14-5-3-6-15-26)36(44)38-22-13-23-39-37(45)31(25-29-19-10-12-21-33(29)47-2)41-35(43)27-16-7-4-8-17-27/h3-12,14-21,24-25H,13,22-23H2,1-2H3,(H,38,44)(H,39,45)(H,40,42)(H,41,43)/b30-24+,31-25+ |
| InChIKey | SZGBKIPNZFPCMF-AMLXCYGQSA-N |
| XLogP | 4.57 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|