C24H31NO4 — CID 70146964
(2E)-2-[[4-(diethylamino)phenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)butan-1-one (PubChem CID 70146964) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2E)-2-[[4-(diethylamino)phenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)butan-1-one.
| Compound Name | (2E)-2-[[4-(diethylamino)phenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 70146964 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (2E)-2-[[4-(diethylamino)phenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)butan-1-one |
| SMILES | CC/C(=C\c1ccc(N(CC)CC)cc1)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H31NO4/c1-7-18(14-17-10-12-20(13-11-17)25(8-2)9-3)23(26)19-15-21(27-4)24(29-6)22(16-19)28-5/h10-16H,7-9H2,1-6H3/b18-14+ |
| InChIKey | QUSQSIJNDZHSDP-NBVRZTHBSA-N |
| XLogP | 5.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|