C22H26BrNO5 — CID 173208501
2-bromo-3-[3-(dimethylamino)-4-ethoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 173208501) has the molecular formula C22H26BrNO5 and a molecular weight of 464.36 g/mol. Its IUPAC name is 2-bromo-3-[3-(dimethylamino)-4-ethoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-bromo-3-[3-(dimethylamino)-4-ethoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173208501 |
| Molecular Formula | C22H26BrNO5 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-bromo-3-[3-(dimethylamino)-4-ethoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=C(Br)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1N(C)C |
| InChI | InChI=1S/C22H26BrNO5/c1-7-29-18-9-8-14(11-17(18)24(2)3)10-16(23)21(25)15-12-19(26-4)22(28-6)20(13-15)27-5/h8-13H,7H2,1-6H3 |
| InChIKey | DFBQKSKHWNDIQS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|