C20H20BrNO5 — CID 87978749
(E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 87978749) has the molecular formula C20H20BrNO5 and a molecular weight of 434.29 g/mol. Its IUPAC name is (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87978749 |
| Molecular Formula | C20H20BrNO5 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C(Br)=C\c2cc(OC)c3c(c2)OCO3)cc1N(C)C |
| InChI | InChI=1S/C20H20BrNO5/c1-22(2)15-10-13(5-6-16(15)24-3)19(23)14(21)7-12-8-17(25-4)20-18(9-12)26-11-27-20/h5-10H,11H2,1-4H3/b14-7+ |
| InChIKey | VRVICDAVDINNHA-VGOFMYFVSA-N |
| XLogP | 4.12 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|