C22H24ClNO5 — CID 87978465
(E)-2-chloro-1-[3-(dimethylamino)-4-ethoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one (PubChem CID 87978465) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is (E)-2-chloro-1-[3-(dimethylamino)-4-ethoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one.
| Compound Name | (E)-2-chloro-1-[3-(dimethylamino)-4-ethoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87978465 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-2-chloro-1-[3-(dimethylamino)-4-ethoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)/C(Cl)=C\c2cc(OC)c3c(c2)OCCO3)cc1N(C)C |
| InChI | InChI=1S/C22H24ClNO5/c1-5-27-18-7-6-15(13-17(18)24(2)3)21(25)16(23)10-14-11-19(26-4)22-20(12-14)28-8-9-29-22/h6-7,10-13H,5,8-9H2,1-4H3/b16-10+ |
| InChIKey | OBHOWTFBBDDJPH-MHWRWJLKSA-N |
| XLogP | 4.39 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|