C20H20ClNO5 — CID 91434404
1-(4-amino-3-ethoxyphenyl)-2-chloro-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one (PubChem CID 91434404) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 1-(4-amino-3-ethoxyphenyl)-2-chloro-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one.
| Compound Name | 1-(4-amino-3-ethoxyphenyl)-2-chloro-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91434404 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-(4-amino-3-ethoxyphenyl)-2-chloro-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(C(=O)C(Cl)=Cc2cc(OC)c3c(c2)OCCO3)ccc1N |
| InChI | InChI=1S/C20H20ClNO5/c1-3-25-16-11-13(4-5-15(16)22)19(23)14(21)8-12-9-17(24-2)20-18(10-12)26-6-7-27-20/h4-5,8-11H,3,6-7,22H2,1-2H3 |
| InChIKey | MFRGJDNCMUBVRE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|