C19H14FNO4 — CID 9373001
(E)-2-(4-fluorobenzoyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enenitrile (PubChem CID 9373001) has the molecular formula C19H14FNO4 and a molecular weight of 339.32 g/mol. Its IUPAC name is (E)-2-(4-fluorobenzoyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-fluorobenzoyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9373001 |
| Molecular Formula | C19H14FNO4 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (E)-2-(4-fluorobenzoyl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2ccc(F)cc2)cc2c1OCCO2 |
| InChI | InChI=1S/C19H14FNO4/c1-23-16-9-12(10-17-19(16)25-7-6-24-17)8-14(11-21)18(22)13-2-4-15(20)5-3-13/h2-5,8-10H,6-7H2,1H3/b14-8+ |
| InChIKey | LRMLBBIYAKXBOJ-RIYZIHGNSA-N |
| XLogP | 3.40 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|