C17H12FNO3 — CID 126397304
(E)-2-(3-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enenitrile (PubChem CID 126397304) has the molecular formula C17H12FNO3 and a molecular weight of 297.29 g/mol. Its IUPAC name is (E)-2-(3-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(3-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126397304 |
| Molecular Formula | C17H12FNO3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (E)-2-(3-fluorophenyl)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)cc2c1OCO2 |
| InChI | InChI=1S/C17H12FNO3/c1-20-15-6-11(7-16-17(15)22-10-21-16)5-13(9-19)12-3-2-4-14(18)8-12/h2-8H,10H2,1H3/b13-5- |
| InChIKey | NMMWTLZIHRJQMM-ACAGNQJTSA-N |
| XLogP | 3.63 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|