C17H13FINO2 — CID 1250153
(E)-2-(3-fluorophenyl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 1250153) has the molecular formula C17H13FINO2 and a molecular weight of 409.20 g/mol. Its IUPAC name is (E)-2-(3-fluorophenyl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(3-fluorophenyl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1250153 |
| Molecular Formula | C17H13FINO2 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | (E)-2-(3-fluorophenyl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)cc(I)c1OC |
| InChI | InChI=1S/C17H13FINO2/c1-21-16-8-11(7-15(19)17(16)22-2)6-13(10-20)12-4-3-5-14(18)9-12/h3-9H,1-2H3/b13-6- |
| InChIKey | IOTFIWBTSIOVIB-MLPAPPSSSA-N |
| XLogP | 4.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|