C23H16Br2FNO2 — CID 126398874
(E)-3-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398874) has the molecular formula C23H16Br2FNO2 and a molecular weight of 517.19 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398874 |
| Molecular Formula | C23H16Br2FNO2 |
| Molecular Weight | 517.19 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | (E)-3-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H16Br2FNO2/c1-28-22-11-16(9-18(13-27)17-3-2-4-20(26)12-17)10-21(25)23(22)29-14-15-5-7-19(24)8-6-15/h2-12H,14H2,1H3/b18-9- |
| InChIKey | YZHOMYXLSDJBMS-NVMNQCDNSA-N |
| XLogP | 7.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.19 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|