C23H17FINO2 — CID 2231404
(E)-2-(3-fluorophenyl)-3-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 2231404) has the molecular formula C23H17FINO2 and a molecular weight of 485.30 g/mol. Its IUPAC name is (E)-2-(3-fluorophenyl)-3-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(3-fluorophenyl)-3-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2231404 |
| Molecular Formula | C23H17FINO2 |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | (E)-2-(3-fluorophenyl)-3-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H17FINO2/c1-27-22-12-17(10-19(14-26)18-8-5-9-20(24)13-18)11-21(25)23(22)28-15-16-6-3-2-4-7-16/h2-13H,15H2,1H3/b19-10- |
| InChIKey | UENFWRDSJFVIML-GRSHGNNSSA-N |
| XLogP | 6.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|