C26H21F2NO2 — CID 126394589
(E)-2-(3-fluorophenyl)-3-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enenitrile (PubChem CID 126394589) has the molecular formula C26H21F2NO2 and a molecular weight of 417.46 g/mol. Its IUPAC name is (E)-2-(3-fluorophenyl)-3-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(3-fluorophenyl)-3-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126394589 |
| Molecular Formula | C26H21F2NO2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (E)-2-(3-fluorophenyl)-3-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(/C#N)c2cccc(F)c2)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H21F2NO2/c1-3-5-21-12-19(13-22(16-29)20-6-4-7-24(28)15-20)14-25(30-2)26(21)31-17-18-8-10-23(27)11-9-18/h3-4,6-15H,1,5,17H2,2H3/b22-13- |
| InChIKey | DHIOOBDYWPTIIE-XKZIYDEJSA-N |
| XLogP | 6.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|