C24H18BrNO4 — CID 126077717
4-[[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126077717) has the molecular formula C24H18BrNO4 and a molecular weight of 464.32 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126077717 |
| Molecular Formula | C24H18BrNO4 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 4-[[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(\C#N)c2ccccc2)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H18BrNO4/c1-29-22-13-17(11-20(14-26)18-5-3-2-4-6-18)12-21(25)23(22)30-15-16-7-9-19(10-8-16)24(27)28/h2-13H,15H2,1H3,(H,27,28)/b20-11+ |
| InChIKey | NVEZGCBTSDFEOQ-RGVLZGJSSA-N |
| XLogP | 5.80 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|