C25H20BrNO4 — CID 21375392
3-[[2-bromo-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 21375392) has the molecular formula C25H20BrNO4 and a molecular weight of 478.34 g/mol. Its IUPAC name is 3-[[2-bromo-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21375392 |
| Molecular Formula | C25H20BrNO4 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 3-[[2-bromo-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(C)cc2)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20BrNO4/c1-16-6-8-19(9-7-16)21(14-27)11-18-12-22(26)24(23(13-18)30-2)31-15-17-4-3-5-20(10-17)25(28)29/h3-13H,15H2,1-2H3,(H,28,29)/b21-11- |
| InChIKey | YVKZALCNKAUGQU-NHDPSOOVSA-N |
| XLogP | 6.11 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|