C23H17Br2NO — CID 124652278
(Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 124652278) has the molecular formula C23H17Br2NO and a molecular weight of 483.20 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124652278 |
| Molecular Formula | C23H17Br2NO |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C/c2cc(Br)c(OCc3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H17Br2NO/c1-16-7-9-19(10-8-16)20(14-26)11-18-12-21(24)23(22(25)13-18)27-15-17-5-3-2-4-6-17/h2-13H,15H2,1H3/b20-11+ |
| InChIKey | MBBJYXPSHOUCNQ-RGVLZGJSSA-N |
| XLogP | 7.16 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|