C18H13Br2NO3 — CID 124652335
2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]acetic acid (PubChem CID 124652335) has the molecular formula C18H13Br2NO3 and a molecular weight of 451.11 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124652335 |
| Molecular Formula | C18H13Br2NO3 |
| Molecular Weight | 451.11 g/mol |
| Exact Mass | 448.93 |
| IUPAC Name | 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(/C(C#N)=C/c2cc(Br)c(OCC(=O)O)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H13Br2NO3/c1-11-2-4-13(5-3-11)14(9-21)6-12-7-15(19)18(16(20)8-12)24-10-17(22)23/h2-8H,10H2,1H3,(H,22,23)/b14-6+ |
| InChIKey | GVKGIFGVTNXCAS-MKMNVTDBSA-N |
| XLogP | 5.05 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.11 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|