C17H10Br2FNO3 — CID 124550936
2-[2,6-dibromo-4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]acetic acid (PubChem CID 124550936) has the molecular formula C17H10Br2FNO3 and a molecular weight of 455.08 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 124550936 |
| Molecular Formula | C17H10Br2FNO3 |
| Molecular Weight | 455.08 g/mol |
| Exact Mass | 452.90 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C/c1cc(Br)c(OCC(=O)O)c(Br)c1)c1ccccc1F |
| InChI | InChI=1S/C17H10Br2FNO3/c18-13-6-10(7-14(19)17(13)24-9-16(22)23)5-11(8-21)12-3-1-2-4-15(12)20/h1-7H,9H2,(H,22,23)/b11-5- |
| InChIKey | BGEMQHQQRGTJTR-WZUFQYTHSA-N |
| XLogP | 4.88 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.08 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|