C17H12BrNO3 — CID 126055874
2-[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]phenoxy]acetic acid (PubChem CID 126055874) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126055874 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-2-cyano-2-phenylethenyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C\c1ccc(OCC(=O)O)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C17H12BrNO3/c18-15-9-12(6-7-16(15)22-11-17(20)21)8-14(10-19)13-4-2-1-3-5-13/h1-9H,11H2,(H,20,21)/b14-8+ |
| InChIKey | WYELEDKFMXLVMG-RIYZIHGNSA-N |
| XLogP | 3.98 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|