C23H15BrFNO3 — CID 3533028
4-[2-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-1-cyanoethenyl]benzoic acid (PubChem CID 3533028) has the molecular formula C23H15BrFNO3 and a molecular weight of 452.28 g/mol. Its IUPAC name is 4-[2-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-1-cyanoethenyl]benzoic acid.
| Compound Name | 4-[2-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-1-cyanoethenyl]benzoic acid |
|---|---|
| PubChem CID | 3533028 |
| Molecular Formula | C23H15BrFNO3 |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-[2-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-1-cyanoethenyl]benzoic acid |
| SMILES | N#CC(=Cc1ccc(OCc2ccccc2F)c(Br)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H15BrFNO3/c24-20-12-15(5-10-22(20)29-14-18-3-1-2-4-21(18)25)11-19(13-26)16-6-8-17(9-7-16)23(27)28/h1-12H,14H2,(H,27,28) |
| InChIKey | JFFNJUNFYWOMII-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|