C18H13BrFN3O3 — CID 126236741
(Z)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide (PubChem CID 126236741) has the molecular formula C18H13BrFN3O3 and a molecular weight of 418.22 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126236741 |
| Molecular Formula | C18H13BrFN3O3 |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(OCc2ccccc2F)c(Br)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C18H13BrFN3O3/c19-14-8-11(7-13(9-21)17(24)23-18(22)25)5-6-16(14)26-10-12-3-1-2-4-15(12)20/h1-8H,10H2,(H3,22,23,24,25)/b13-7- |
| InChIKey | FISMGDGIIMRHGJ-QPEQYQDCSA-N |
| XLogP | 3.27 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|