C18H13ClIN3O3 — CID 126233719
(Z)-N-carbamoyl-3-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]-2-cyanoprop-2-enamide (PubChem CID 126233719) has the molecular formula C18H13ClIN3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is (Z)-N-carbamoyl-3-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-carbamoyl-3-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126233719 |
| Molecular Formula | C18H13ClIN3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | (Z)-N-carbamoyl-3-[4-[(2-chlorophenyl)methoxy]-3-iodophenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(OCc2ccccc2Cl)c(I)c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C18H13ClIN3O3/c19-14-4-2-1-3-12(14)10-26-16-6-5-11(8-15(16)20)7-13(9-21)17(24)23-18(22)25/h1-8H,10H2,(H3,22,23,24,25)/b13-7- |
| InChIKey | PTCWIVZFWHSNHW-QPEQYQDCSA-N |
| XLogP | 3.63 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|