C26H22ClIN2O2 — CID 126243427
(Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126243427) has the molecular formula C26H22ClIN2O2 and a molecular weight of 556.83 g/mol. Its IUPAC name is (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126243427 |
| Molecular Formula | C26H22ClIN2O2 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(OCc2ccc(Cl)cc2)c(I)c1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H22ClIN2O2/c27-23-11-8-20(9-12-23)18-32-25-13-10-21(16-24(25)28)15-22(17-29)26(31)30-14-4-7-19-5-2-1-3-6-19/h1-3,5-6,8-13,15-16H,4,7,14,18H2,(H,30,31)/b22-15- |
| InChIKey | ITHZNMUIZYZSOF-JCMHNJIXSA-N |
| XLogP | 6.18 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|