C23H17BrClNO — CID 21374888
(E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21374888) has the molecular formula C23H17BrClNO and a molecular weight of 438.75 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21374888 |
| Molecular Formula | C23H17BrClNO |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C\c2ccc(OCc3ccccc3Cl)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H17BrClNO/c1-16-6-9-18(10-7-16)20(14-26)12-17-8-11-23(21(24)13-17)27-15-19-4-2-3-5-22(19)25/h2-13H,15H2,1H3/b20-12- |
| InChIKey | IXKVNULTOZGTRC-NDENLUEZSA-N |
| XLogP | 7.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|