C18H11BrN2O6 — CID 21381785
2-[2-bromo-4-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]acetic acid (PubChem CID 21381785) has the molecular formula C18H11BrN2O6 and a molecular weight of 431.20 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21381785 |
| Molecular Formula | C18H11BrN2O6 |
| Molecular Weight | 431.20 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C/c1ccc(OCC(=O)O)c(Br)c1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H11BrN2O6/c19-15-7-11(4-5-16(15)27-10-17(22)23)6-13(9-20)18(24)12-2-1-3-14(8-12)21(25)26/h1-8H,10H2,(H,22,23)/b13-6- |
| InChIKey | KFIQQBDKVZMZTI-MLPAPPSSSA-N |
| XLogP | 3.61 |
| TPSA | 130.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|