C23H13BrCl2N2O4 — CID 4275240
3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile (PubChem CID 4275240) has the molecular formula C23H13BrCl2N2O4 and a molecular weight of 532.18 g/mol. Its IUPAC name is 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile.
| Compound Name | 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4275240 |
| Molecular Formula | C23H13BrCl2N2O4 |
| Molecular Weight | 532.18 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2ccc(Cl)cc2Cl)c(Br)c1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H13BrCl2N2O4/c24-20-9-14(4-7-22(20)32-13-16-5-6-18(25)11-21(16)26)8-17(12-27)23(29)15-2-1-3-19(10-15)28(30)31/h1-11H,13H2 |
| InChIKey | VHNARASMTNZGEG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.18 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|