C24H15BrCl2N2O5 — CID 6287349
(E)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile (PubChem CID 6287349) has the molecular formula C24H15BrCl2N2O5 and a molecular weight of 562.20 g/mol. Its IUPAC name is (E)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6287349 |
| Molecular Formula | C24H15BrCl2N2O5 |
| Molecular Weight | 562.20 g/mol |
| Exact Mass | 559.95 |
| IUPAC Name | (E)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(3-nitrobenzoyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2cccc([N+](=O)[O-])c2)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15BrCl2N2O5/c1-33-22-9-16(7-17(12-28)24(30)14-3-2-4-19(8-14)29(31)32)20(25)11-23(22)34-13-15-5-6-18(26)10-21(15)27/h2-11H,13H2,1H3/b17-7+ |
| InChIKey | VYRAAHVCOXSLJQ-REZTVBANSA-N |
| XLogP | 7.04 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.20 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|