C23H15BrFN3O4 — CID 5136904
2-[2-bromo-4-[2-cyano-2-(3-nitrophenyl)ethenyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 5136904) has the molecular formula C23H15BrFN3O4 and a molecular weight of 496.29 g/mol. Its IUPAC name is 2-[2-bromo-4-[2-cyano-2-(3-nitrophenyl)ethenyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[2-cyano-2-(3-nitrophenyl)ethenyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 5136904 |
| Molecular Formula | C23H15BrFN3O4 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 2-[2-bromo-4-[2-cyano-2-(3-nitrophenyl)ethenyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | N#CC(=Cc1ccc(OCC(=O)Nc2ccc(F)cc2)c(Br)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15BrFN3O4/c24-21-11-15(10-17(13-26)16-2-1-3-20(12-16)28(30)31)4-9-22(21)32-14-23(29)27-19-7-5-18(25)6-8-19/h1-12H,14H2,(H,27,29) |
| InChIKey | FFPHEYXUQGHWKJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|