C17H10BrClN2O5 — CID 126207514
2-[2-bromo-6-chloro-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]acetic acid (PubChem CID 126207514) has the molecular formula C17H10BrClN2O5 and a molecular weight of 437.63 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-chloro-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126207514 |
| Molecular Formula | C17H10BrClN2O5 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[(E)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]acetic acid |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCC(=O)O)c(Br)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10BrClN2O5/c18-14-6-10(7-15(19)17(14)26-9-16(22)23)5-12(8-20)11-1-3-13(4-2-11)21(24)25/h1-7H,9H2,(H,22,23)/b12-5- |
| InChIKey | LCKZHCRCQSEYGF-XGICHPGQSA-N |
| XLogP | 4.54 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|