C24H17Br2N3O4 — CID 126268149
2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126268149) has the molecular formula C24H17Br2N3O4 and a molecular weight of 571.23 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126268149 |
| Molecular Formula | C24H17Br2N3O4 |
| Molecular Weight | 571.23 g/mol |
| Exact Mass | 568.96 |
| IUPAC Name | 2-[2,6-dibromo-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1c(Br)cc(/C=C(\C#N)c2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C24H17Br2N3O4/c1-15-4-2-3-5-22(15)28-23(30)14-33-24-20(25)11-16(12-21(24)26)10-18(13-27)17-6-8-19(9-7-17)29(31)32/h2-12H,14H2,1H3,(H,28,30)/b18-10+ |
| InChIKey | GLHCGBDJSRNKKT-VCHYOVAHSA-N |
| XLogP | 6.51 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.23 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|