C23H16Br2N2O3 — CID 126051431
(Z)-3-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126051431) has the molecular formula C23H16Br2N2O3 and a molecular weight of 528.20 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126051431 |
| Molecular Formula | C23H16Br2N2O3 |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | (Z)-3-[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(COc2c(Br)cc(/C=C(\C#N)c3ccc([N+](=O)[O-])cc3)cc2Br)cc1 |
| InChI | InChI=1S/C23H16Br2N2O3/c1-15-2-4-16(5-3-15)14-30-23-21(24)11-17(12-22(23)25)10-19(13-26)18-6-8-20(9-7-18)27(28)29/h2-12H,14H2,1H3/b19-10+ |
| InChIKey | XHEYJCQBVUMKDH-VXLYETTFSA-N |
| XLogP | 7.07 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|