C25H21BrN2O4 — CID 126215532
(E)-3-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126215532) has the molecular formula C25H21BrN2O4 and a molecular weight of 493.36 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126215532 |
| Molecular Formula | C25H21BrN2O4 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc([N+](=O)[O-])cc2)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H21BrN2O4/c1-3-31-24-14-19(12-21(15-27)20-8-10-22(11-9-20)28(29)30)13-23(26)25(24)32-16-18-6-4-17(2)5-7-18/h4-14H,3,16H2,1-2H3/b21-12- |
| InChIKey | FREXSOLVFZLRTF-MTJSOVHGSA-N |
| XLogP | 6.71 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|