C17H13Br2NO — CID 124652289
(Z)-3-(3,5-dibromo-4-methoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 124652289) has the molecular formula C17H13Br2NO and a molecular weight of 407.11 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-4-methoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-4-methoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124652289 |
| Molecular Formula | C17H13Br2NO |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | (Z)-3-(3,5-dibromo-4-methoxyphenyl)-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | COc1c(Br)cc(/C=C(\C#N)c2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C17H13Br2NO/c1-11-3-5-13(6-4-11)14(10-20)7-12-8-15(18)17(21-2)16(19)9-12/h3-9H,1-2H3/b14-7+ |
| InChIKey | VPCRXBCBIGGWGC-VGOFMYFVSA-N |
| XLogP | 5.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|