C28H28BrNO5 — CID 7129663
(E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 7129663) has the molecular formula C28H28BrNO5 and a molecular weight of 538.44 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 7129663 |
| Molecular Formula | C28H28BrNO5 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(OC)c(OC)c2)cc(Br)c1OCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C28H28BrNO5/c1-5-33-27-16-20(14-22(18-30)21-8-11-25(31-3)26(17-21)32-4)15-24(29)28(27)35-13-12-34-23-9-6-19(2)7-10-23/h6-11,14-17H,5,12-13H2,1-4H3/b22-14- |
| InChIKey | SWKQSMUNCBSYNS-HMAPJEAMSA-N |
| XLogP | 6.70 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|