C26H24BrNO3 — CID 7129664
(E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-phenylprop-2-enenitrile (PubChem CID 7129664) has the molecular formula C26H24BrNO3 and a molecular weight of 478.39 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 7129664 |
| Molecular Formula | C26H24BrNO3 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-phenylprop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccccc2)cc(Br)c1OCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C26H24BrNO3/c1-3-29-25-17-20(15-22(18-28)21-7-5-4-6-8-21)16-24(27)26(25)31-14-13-30-23-11-9-19(2)10-12-23/h4-12,15-17H,3,13-14H2,1-2H3/b22-15- |
| InChIKey | PVIIWSDDXOJNKF-JCMHNJIXSA-N |
| XLogP | 6.68 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|