C24H26BrNO5 — CID 5128850
ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 5128850) has the molecular formula C24H26BrNO5 and a molecular weight of 488.38 g/mol. Its IUPAC name is ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 5128850 |
| Molecular Formula | C24H26BrNO5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(Br)c(OCCOc2ccc(C)c(C)c2)c(OCC)c1 |
| InChI | InChI=1S/C24H26BrNO5/c1-5-28-22-14-18(12-19(15-26)24(27)29-6-2)13-21(25)23(22)31-10-9-30-20-8-7-16(3)17(4)11-20/h7-8,11-14H,5-6,9-10H2,1-4H3 |
| InChIKey | MYVLONSKZVLCHB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|