About ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate
ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 5128850) has the molecular formula C24H26BrNO5
and a molecular weight of 488.38 g/mol. Its IUPAC name is ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate |
| PubChem CID | 5128850 |
| Molecular Formula | C24H26BrNO5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(Br)c(OCCOc2ccc(C)c(C)c2)c(OCC)c1 |
| InChI | InChI=1S/C24H26BrNO5/c1-5-28-22-14-18(12-19(15-26)24(27)29-6-2)13-21(25)23(22)31-10-9-30-20-8-7-16(3)17(4)11-20/h7-8,11-14H,5-6,9-10H2,1-4H3 |
| InChIKey | MYVLONSKZVLCHB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate?
The IUPAC name of ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate (CID 5128850) is ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate.
What is the SMILES notation for ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate?
The canonical SMILES for ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate is CCOC(=O)C(C#N)=Cc1cc(Br)c(OCCOc2ccc(C)c(C)c2)c(OCC)c1.
What is the InChIKey of ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate?
The InChIKey is MYVLONSKZVLCHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26BrNO5/c1-5-28-22-14-18(12-19(15-26)24(27)29-6-2)13-21(25)23(22)31-10-9-30-20-8-7-16(3)17(4)11-20/h7-8,11-14H,5-6,9-10H2,1-4H3.
What are the key properties of ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate?
ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate has a molecular weight of 488.38 g/mol, XLogP of 5.39, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enoate is sourced from PubChem (CID 5128850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).