C21H26BrN3O3S — CID 3648708
1-[[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-methylthiourea (PubChem CID 3648708) has the molecular formula C21H26BrN3O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is 1-[[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-methylthiourea.
| Compound Name | 1-[[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 3648708 |
| Molecular Formula | C21H26BrN3O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 1-[[3-bromo-4-[2-(3,4-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-methylthiourea |
| SMILES | CCOc1cc(C=NNC(=S)NC)cc(Br)c1OCCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H26BrN3O3S/c1-5-26-19-12-16(13-24-25-21(29)23-4)11-18(22)20(19)28-9-8-27-17-7-6-14(2)15(3)10-17/h6-7,10-13H,5,8-9H2,1-4H3,(H2,23,25,29) |
| InChIKey | KDSRMILKVUNGTQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|