C25H34ClN3O4S — CID 18552644
1-[(E)-[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-3-methylthiourea (PubChem CID 18552644) has the molecular formula C25H34ClN3O4S and a molecular weight of 508.08 g/mol. Its IUPAC name is 1-[(E)-[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 18552644 |
| Molecular Formula | C25H34ClN3O4S |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 1-[(E)-[3-chloro-5-ethoxy-4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-3-methylthiourea |
| SMILES | CCCCCCOc1ccc(OCCOc2c(Cl)cc(/C=N/NC(=S)NC)cc2OCC)cc1 |
| InChI | InChI=1S/C25H34ClN3O4S/c1-4-6-7-8-13-31-20-9-11-21(12-10-20)32-14-15-33-24-22(26)16-19(17-23(24)30-5-2)18-28-29-25(34)27-3/h9-12,16-18H,4-8,13-15H2,1-3H3,(H2,27,29,34)/b28-18+ |
| InChIKey | CHXZEBIYPRTWKE-MTDXEUNCSA-N |
| XLogP | 5.58 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|