C20H22Cl2N2O5 — CID 6300387
methyl N-[(Z)-[3-chloro-4-[3-(4-chlorophenoxy)propoxy]-5-ethoxyphenyl]methylideneamino]carbamate (PubChem CID 6300387) has the molecular formula C20H22Cl2N2O5 and a molecular weight of 441.31 g/mol. Its IUPAC name is methyl N-[(Z)-[3-chloro-4-[3-(4-chlorophenoxy)propoxy]-5-ethoxyphenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-[3-chloro-4-[3-(4-chlorophenoxy)propoxy]-5-ethoxyphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6300387 |
| Molecular Formula | C20H22Cl2N2O5 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | methyl N-[(Z)-[3-chloro-4-[3-(4-chlorophenoxy)propoxy]-5-ethoxyphenyl]methylideneamino]carbamate |
| SMILES | CCOc1cc(/C=N\NC(=O)OC)cc(Cl)c1OCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O5/c1-3-27-18-12-14(13-23-24-20(25)26-2)11-17(22)19(18)29-10-4-9-28-16-7-5-15(21)6-8-16/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,24,25)/b23-13- |
| InChIKey | HWAGWXMZSHIQKV-QRVIBDJDSA-N |
| XLogP | 4.93 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|