C21H25ClN2O6 — CID 3597102
methyl N-[[3-chloro-5-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]carbamate (PubChem CID 3597102) has the molecular formula C21H25ClN2O6 and a molecular weight of 436.89 g/mol. Its IUPAC name is methyl N-[[3-chloro-5-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[[3-chloro-5-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 3597102 |
| Molecular Formula | C21H25ClN2O6 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl N-[[3-chloro-5-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]carbamate |
| SMILES | CCOc1cc(C=NNC(=O)OC)cc(Cl)c1OCCCOc1cccc(OC)c1 |
| InChI | InChI=1S/C21H25ClN2O6/c1-4-28-19-12-15(14-23-24-21(25)27-3)11-18(22)20(19)30-10-6-9-29-17-8-5-7-16(13-17)26-2/h5,7-8,11-14H,4,6,9-10H2,1-3H3,(H,24,25) |
| InChIKey | YRCKEAFDJALTID-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|