C27H34ClN3O3S — CID 3307954
1-[[3-chloro-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-prop-2-enylthiourea (PubChem CID 3307954) has the molecular formula C27H34ClN3O3S and a molecular weight of 516.11 g/mol. Its IUPAC name is 1-[[3-chloro-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[3-chloro-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3307954 |
| Molecular Formula | C27H34ClN3O3S |
| Molecular Weight | 516.11 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1-[[3-chloro-4-[2-(4-cyclohexylphenoxy)ethoxy]-5-ethoxyphenyl]methylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NN=Cc1cc(Cl)c(OCCOc2ccc(C3CCCCC3)cc2)c(OCC)c1 |
| InChI | InChI=1S/C27H34ClN3O3S/c1-3-14-29-27(35)31-30-19-20-17-24(28)26(25(18-20)32-4-2)34-16-15-33-23-12-10-22(11-13-23)21-8-6-5-7-9-21/h3,10-13,17-19,21H,1,4-9,14-16H2,2H3,(H2,29,31,35) |
| InChIKey | FMKMTPYSCGLWGE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.11 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|