C27H29Cl2N3O2S — CID 6883668
1-benzyl-3-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]thiourea (PubChem CID 6883668) has the molecular formula C27H29Cl2N3O2S and a molecular weight of 530.52 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6883668 |
| Molecular Formula | C27H29Cl2N3O2S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-benzyl-3-[(E)-[4-[2-(4-tert-butylphenoxy)ethoxy]-3,5-dichlorophenyl]methylideneamino]thiourea |
| SMILES | CC(C)(C)c1ccc(OCCOc2c(Cl)cc(/C=N/NC(=S)NCc3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C27H29Cl2N3O2S/c1-27(2,3)21-9-11-22(12-10-21)33-13-14-34-25-23(28)15-20(16-24(25)29)18-31-32-26(35)30-17-19-7-5-4-6-8-19/h4-12,15-16,18H,13-14,17H2,1-3H3,(H2,30,32,35)/b31-18+ |
| InChIKey | YSQISATUINRSQU-FDAWAROLSA-N |
| XLogP | 6.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|