C19H22ClN3O2S — CID 110533003
1-benzyl-3-[(Z)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]thiourea (PubChem CID 110533003) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is 1-benzyl-3-[(Z)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(Z)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 110533003 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-benzyl-3-[(Z)-(3-chloro-4,5-diethoxyphenyl)methylideneamino]thiourea |
| SMILES | CCOc1cc(/C=N\NC(=S)NCc2ccccc2)cc(Cl)c1OCC |
| InChI | InChI=1S/C19H22ClN3O2S/c1-3-24-17-11-15(10-16(20)18(17)25-4-2)13-22-23-19(26)21-12-14-8-6-5-7-9-14/h5-11,13H,3-4,12H2,1-2H3,(H2,21,23,26)/b22-13- |
| InChIKey | LNTPYCBEIDMJMQ-XKZIYDEJSA-N |
| XLogP | 4.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|