C13H19N3O2S — CID 48834861
1-[(E)-(3,4-diethoxyphenyl)methylideneamino]-3-methylthiourea (PubChem CID 48834861) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[(E)-(3,4-diethoxyphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(3,4-diethoxyphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 48834861 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[(E)-(3,4-diethoxyphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CCOc1ccc(/C=N/NC(=S)NC)cc1OCC |
| InChI | InChI=1S/C13H19N3O2S/c1-4-17-11-7-6-10(8-12(11)18-5-2)9-15-16-13(19)14-3/h6-9H,4-5H2,1-3H3,(H2,14,16,19)/b15-9+ |
| InChIKey | UXHPBWIPXRHHLN-OQLLNIDSSA-N |
| XLogP | 1.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|