C22H22ClNO6 — CID 4269752
ethyl 3-[3-chloro-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enoate (PubChem CID 4269752) has the molecular formula C22H22ClNO6 and a molecular weight of 431.87 g/mol. Its IUPAC name is ethyl 3-[3-chloro-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[3-chloro-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4269752 |
| Molecular Formula | C22H22ClNO6 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | ethyl 3-[3-chloro-5-methoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cc(Cl)c(OCCOc2cccc(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C22H22ClNO6/c1-4-28-22(25)16(14-24)10-15-11-19(23)21(20(12-15)27-3)30-9-8-29-18-7-5-6-17(13-18)26-2/h5-7,10-13H,4,8-9H2,1-3H3 |
| InChIKey | KMGVBRFANOKIIB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|