C23H17BrN2O6S — CID 3695029
[2-bromo-4-[2-cyano-2-(4-nitrophenyl)ethenyl]-6-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 3695029) has the molecular formula C23H17BrN2O6S and a molecular weight of 529.37 g/mol. Its IUPAC name is [2-bromo-4-[2-cyano-2-(4-nitrophenyl)ethenyl]-6-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-4-[2-cyano-2-(4-nitrophenyl)ethenyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3695029 |
| Molecular Formula | C23H17BrN2O6S |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | [2-bromo-4-[2-cyano-2-(4-nitrophenyl)ethenyl]-6-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C=C(C#N)c2ccc([N+](=O)[O-])cc2)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H17BrN2O6S/c1-15-3-9-20(10-4-15)33(29,30)32-23-21(24)12-16(13-22(23)31-2)11-18(14-25)17-5-7-19(8-6-17)26(27)28/h3-13H,1-2H3 |
| InChIKey | IQRQLWXWCRKCSG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 119.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|