C17H12BrN3O7S — CID 2885625
[4-(3-amino-2-cyano-3-oxoprop-1-enyl)-2-bromo-6-methoxyphenyl] 4-nitrobenzenesulfonate (PubChem CID 2885625) has the molecular formula C17H12BrN3O7S and a molecular weight of 482.27 g/mol. Its IUPAC name is [4-(3-amino-2-cyano-3-oxoprop-1-enyl)-2-bromo-6-methoxyphenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-(3-amino-2-cyano-3-oxoprop-1-enyl)-2-bromo-6-methoxyphenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2885625 |
| Molecular Formula | C17H12BrN3O7S |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | [4-(3-amino-2-cyano-3-oxoprop-1-enyl)-2-bromo-6-methoxyphenyl] 4-nitrobenzenesulfonate |
| SMILES | COc1cc(C=C(C#N)C(N)=O)cc(Br)c1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12BrN3O7S/c1-27-15-8-10(6-11(9-19)17(20)22)7-14(18)16(15)28-29(25,26)13-4-2-12(3-5-13)21(23)24/h2-8H,1H3,(H2,20,22) |
| InChIKey | LACKSQICQUNXPJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|