C17H10Br2N2 — CID 126373068
4-[(E)-1-cyano-2-(3,5-dibromo-4-methylphenyl)ethenyl]benzonitrile (PubChem CID 126373068) has the molecular formula C17H10Br2N2 and a molecular weight of 402.09 g/mol. Its IUPAC name is 4-[(E)-1-cyano-2-(3,5-dibromo-4-methylphenyl)ethenyl]benzonitrile.
| Compound Name | 4-[(E)-1-cyano-2-(3,5-dibromo-4-methylphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 126373068 |
| Molecular Formula | C17H10Br2N2 |
| Molecular Weight | 402.09 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 4-[(E)-1-cyano-2-(3,5-dibromo-4-methylphenyl)ethenyl]benzonitrile |
| SMILES | Cc1c(Br)cc(/C=C(/C#N)c2ccc(C#N)cc2)cc1Br |
| InChI | InChI=1S/C17H10Br2N2/c1-11-16(18)7-13(8-17(11)19)6-15(10-21)14-4-2-12(9-20)3-5-14/h2-8H,1H3/b15-6- |
| InChIKey | UWWPNJQJVSBTAX-UUASQNMZSA-N |
| XLogP | 5.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.09 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|