C16H8Cl2N2 — CID 967403
4-[(Z)-1-cyano-2-(2,4-dichlorophenyl)ethenyl]benzonitrile (PubChem CID 967403) has the molecular formula C16H8Cl2N2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 4-[(Z)-1-cyano-2-(2,4-dichlorophenyl)ethenyl]benzonitrile.
| Compound Name | 4-[(Z)-1-cyano-2-(2,4-dichlorophenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 967403 |
| Molecular Formula | C16H8Cl2N2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-[(Z)-1-cyano-2-(2,4-dichlorophenyl)ethenyl]benzonitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1Cl)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H8Cl2N2/c17-15-6-5-13(16(18)8-15)7-14(10-20)12-3-1-11(9-19)2-4-12/h1-8H/b14-7+ |
| InChIKey | VKXQGIYKMLIQEF-VGOFMYFVSA-N |
| XLogP | 4.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|